C21H38O5 — CID 10339155
(4S,5R)-5-[10-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]decyl]-2,2-dimethyl-1,3-dioxolane-4-carbaldehyde (PubChem CID 10339155) has the molecular formula C21H38O5 and a molecular weight of 370.53 g/mol. Its IUPAC name is (4S,5R)-5-[10-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]decyl]-2,2-dimethyl-1,3-dioxolane-4-carbaldehyde.
| Compound Name | (4S,5R)-5-[10-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]decyl]-2,2-dimethyl-1,3-dioxolane-4-carbaldehyde |
|---|---|
| PubChem CID | 10339155 |
| Molecular Formula | C21H38O5 |
| Molecular Weight | 370.53 g/mol |
| Exact Mass | 370.27 |
| IUPAC Name | (4S,5R)-5-[10-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]decyl]-2,2-dimethyl-1,3-dioxolane-4-carbaldehyde |
| SMILES | CC1(C)OC[C@@H](CCCCCCCCCC[C@H]2OC(C)(C)O[C@@H]2C=O)O1 |
| InChI | InChI=1S/C21H38O5/c1-20(2)23-16-17(24-20)13-11-9-7-5-6-8-10-12-14-18-19(15-22)26-21(3,4)25-18/h15,17-19H,5-14,16H2,1-4H3/t17-,18-,19-/m1/s1 |
| InChIKey | DPFAEYBCYUDEQL-GUDVDZBRSA-N |
| XLogP | 4.76 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.53 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|