C15H24N2O — CID 103391625
4-(3,4-dihydro-2H-quinolin-1-yl)-5-methoxypentan-1-amine (PubChem CID 103391625) has the molecular formula C15H24N2O and a molecular weight of 248.37 g/mol. Its IUPAC name is 4-(3,4-dihydro-2H-quinolin-1-yl)-5-methoxypentan-1-amine.
| Compound Name | 4-(3,4-dihydro-2H-quinolin-1-yl)-5-methoxypentan-1-amine |
|---|---|
| PubChem CID | 103391625 |
| Molecular Formula | C15H24N2O |
| Molecular Weight | 248.37 g/mol |
| Exact Mass | 248.19 |
| IUPAC Name | 4-(3,4-dihydro-2H-quinolin-1-yl)-5-methoxypentan-1-amine |
| SMILES | COCC(CCCN)N1CCCc2ccccc21 |
| InChI | InChI=1S/C15H24N2O/c1-18-12-14(8-4-10-16)17-11-5-7-13-6-2-3-9-15(13)17/h2-3,6,9,14H,4-5,7-8,10-12,16H2,1H3 |
| InChIKey | QYQSWHCGFRRGIC-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.37 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |