C11H26N2O2 — CID 103392024
4-[(5-amino-1-methoxypentan-2-yl)-methylamino]butan-2-ol (PubChem CID 103392024) has the molecular formula C11H26N2O2 and a molecular weight of 218.34 g/mol. Its IUPAC name is 4-[(5-amino-1-methoxypentan-2-yl)-methylamino]butan-2-ol.
| Compound Name | 4-[(5-amino-1-methoxypentan-2-yl)-methylamino]butan-2-ol |
|---|---|
| PubChem CID | 103392024 |
| Molecular Formula | C11H26N2O2 |
| Molecular Weight | 218.34 g/mol |
| Exact Mass | 218.20 |
| IUPAC Name | 4-[(5-amino-1-methoxypentan-2-yl)-methylamino]butan-2-ol |
| SMILES | COCC(CCCN)N(C)CCC(C)O |
| InChI | InChI=1S/C11H26N2O2/c1-10(14)6-8-13(2)11(9-15-3)5-4-7-12/h10-11,14H,4-9,12H2,1-3H3 |
| InChIKey | CZEXQKFVBVSVAI-UHFFFAOYSA-N |
| XLogP | 0.44 |
| TPSA | 58.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.34 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |