C14H27FN4O2 — CID 103392389
4-[1-[2-(dimethylamino)ethyl]-4-methoxypyrazol-5-yl]-4-fluoro-5-methoxypentan-1-amine (PubChem CID 103392389) has the molecular formula C14H27FN4O2 and a molecular weight of 302.39 g/mol. Its IUPAC name is 4-[1-[2-(dimethylamino)ethyl]-4-methoxypyrazol-5-yl]-4-fluoro-5-methoxypentan-1-amine.
| Compound Name | 4-[1-[2-(dimethylamino)ethyl]-4-methoxypyrazol-5-yl]-4-fluoro-5-methoxypentan-1-amine |
|---|---|
| PubChem CID | 103392389 |
| Molecular Formula | C14H27FN4O2 |
| Molecular Weight | 302.39 g/mol |
| Exact Mass | 302.21 |
| IUPAC Name | 4-[1-[2-(dimethylamino)ethyl]-4-methoxypyrazol-5-yl]-4-fluoro-5-methoxypentan-1-amine |
| SMILES | COCC(F)(CCCN)c1c(OC)cnn1CCN(C)C |
| InChI | InChI=1S/C14H27FN4O2/c1-18(2)8-9-19-13(12(21-4)10-17-19)14(15,11-20-3)6-5-7-16/h10H,5-9,11,16H2,1-4H3 |
| InChIKey | VYVFUIRKFOLHGF-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 65.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.39 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |