C14H14BrClFNOS — CID 103394718
N-[(5-bromo-4-fluoro-2-methoxyphenyl)-(5-chlorothiophen-2-yl)methyl]ethanamine (PubChem CID 103394718) has the molecular formula C14H14BrClFNOS and a molecular weight of 378.69 g/mol. Its IUPAC name is N-[(5-bromo-4-fluoro-2-methoxyphenyl)-(5-chlorothiophen-2-yl)methyl]ethanamine.
| Compound Name | N-[(5-bromo-4-fluoro-2-methoxyphenyl)-(5-chlorothiophen-2-yl)methyl]ethanamine |
|---|---|
| PubChem CID | 103394718 |
| Molecular Formula | C14H14BrClFNOS |
| Molecular Weight | 378.69 g/mol |
| Exact Mass | 376.97 |
| IUPAC Name | N-[(5-bromo-4-fluoro-2-methoxyphenyl)-(5-chlorothiophen-2-yl)methyl]ethanamine |
| SMILES | CCNC(c1ccc(Cl)s1)c1cc(Br)c(F)cc1OC |
| InChI | InChI=1S/C14H14BrClFNOS/c1-3-18-14(12-4-5-13(16)20-12)8-6-9(15)10(17)7-11(8)19-2/h4-7,14,18H,3H2,1-2H3 |
| InChIKey | BIKVHJNRGXXUFG-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.69 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |