C14H14BrClFNS — CID 43497043
N-[(2-bromo-5-fluorophenyl)-(5-chlorothiophen-2-yl)methyl]propan-1-amine (PubChem CID 43497043) has the molecular formula C14H14BrClFNS and a molecular weight of 362.70 g/mol. Its IUPAC name is N-[(2-bromo-5-fluorophenyl)-(5-chlorothiophen-2-yl)methyl]propan-1-amine.
| Compound Name | N-[(2-bromo-5-fluorophenyl)-(5-chlorothiophen-2-yl)methyl]propan-1-amine |
|---|---|
| PubChem CID | 43497043 |
| Molecular Formula | C14H14BrClFNS |
| Molecular Weight | 362.70 g/mol |
| Exact Mass | 360.97 |
| IUPAC Name | N-[(2-bromo-5-fluorophenyl)-(5-chlorothiophen-2-yl)methyl]propan-1-amine |
| SMILES | CCCNC(c1ccc(Cl)s1)c1cc(F)ccc1Br |
| InChI | InChI=1S/C14H14BrClFNS/c1-2-7-18-14(12-5-6-13(16)19-12)10-8-9(17)3-4-11(10)15/h3-6,8,14,18H,2,7H2,1H3 |
| InChIKey | JOWNTUABDBDMQH-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.70 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |