C11H12FN3O2 — CID 103395395
(5-amino-1H-pyrazol-4-yl)-(2-fluoro-4-methoxyphenyl)methanol (PubChem CID 103395395) has the molecular formula C11H12FN3O2 and a molecular weight of 237.23 g/mol. Its IUPAC name is (5-amino-1H-pyrazol-4-yl)-(2-fluoro-4-methoxyphenyl)methanol.
| Compound Name | (5-amino-1H-pyrazol-4-yl)-(2-fluoro-4-methoxyphenyl)methanol |
|---|---|
| PubChem CID | 103395395 |
| Molecular Formula | C11H12FN3O2 |
| Molecular Weight | 237.23 g/mol |
| Exact Mass | 237.09 |
| IUPAC Name | (5-amino-1H-pyrazol-4-yl)-(2-fluoro-4-methoxyphenyl)methanol |
| SMILES | COc1ccc(C(O)c2cn[nH]c2N)c(F)c1 |
| InChI | InChI=1S/C11H12FN3O2/c1-17-6-2-3-7(9(12)4-6)10(16)8-5-14-15-11(8)13/h2-5,10,16H,1H3,(H3,13,14,15) |
| InChIKey | RBEXZROZSUUFLI-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 84.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.23 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |