C10H9F2N3O — CID 65361938
(5-amino-1H-pyrazol-4-yl)-(2,6-difluorophenyl)methanol (PubChem CID 65361938) has the molecular formula C10H9F2N3O and a molecular weight of 225.20 g/mol. Its IUPAC name is (5-amino-1H-pyrazol-4-yl)-(2,6-difluorophenyl)methanol.
| Compound Name | (5-amino-1H-pyrazol-4-yl)-(2,6-difluorophenyl)methanol |
|---|---|
| PubChem CID | 65361938 |
| Molecular Formula | C10H9F2N3O |
| Molecular Weight | 225.20 g/mol |
| Exact Mass | 225.07 |
| IUPAC Name | (5-amino-1H-pyrazol-4-yl)-(2,6-difluorophenyl)methanol |
| SMILES | Nc1[nH]ncc1C(O)c1c(F)cccc1F |
| InChI | InChI=1S/C10H9F2N3O/c11-6-2-1-3-7(12)8(6)9(16)5-4-14-15-10(5)13/h1-4,9,16H,(H3,13,14,15) |
| InChIKey | MVCRHAIGNMDTCS-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 74.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.20 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |