C12H10BrFN2O — CID 114885595
(4-amino-3-pyridinyl)-(2-bromo-6-fluorophenyl)methanol (PubChem CID 114885595) has the molecular formula C12H10BrFN2O and a molecular weight of 297.13 g/mol. Its IUPAC name is (4-amino-3-pyridinyl)-(2-bromo-6-fluorophenyl)methanol.
| Compound Name | (4-amino-3-pyridinyl)-(2-bromo-6-fluorophenyl)methanol |
|---|---|
| PubChem CID | 114885595 |
| Molecular Formula | C12H10BrFN2O |
| Molecular Weight | 297.13 g/mol |
| Exact Mass | 296.00 |
| IUPAC Name | (4-amino-3-pyridinyl)-(2-bromo-6-fluorophenyl)methanol |
| SMILES | Nc1ccncc1C(O)c1c(F)cccc1Br |
| InChI | InChI=1S/C12H10BrFN2O/c13-8-2-1-3-9(14)11(8)12(17)7-6-16-5-4-10(7)15/h1-6,12,17H,(H2,15,16) |
| InChIKey | XDOMNZRBXGYBOU-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 59.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.13 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |