C15H25BrO4Si — CID 10339544
(3aR,7S,7aS)-5-bromo-7-[tert-butyl(dimethyl)silyl]oxy-2,2-dimethyl-7,7a-dihydro-3aH-1,3-benzodioxol-4-one (PubChem CID 10339544) has the molecular formula C15H25BrO4Si and a molecular weight of 377.35 g/mol. Its IUPAC name is (3aR,7S,7aS)-5-bromo-7-[tert-butyl(dimethyl)silyl]oxy-2,2-dimethyl-7,7a-dihydro-3aH-1,3-benzodioxol-4-one.
| Compound Name | (3aR,7S,7aS)-5-bromo-7-[tert-butyl(dimethyl)silyl]oxy-2,2-dimethyl-7,7a-dihydro-3aH-1,3-benzodioxol-4-one |
|---|---|
| PubChem CID | 10339544 |
| Molecular Formula | C15H25BrO4Si |
| Molecular Weight | 377.35 g/mol |
| Exact Mass | 376.07 |
| IUPAC Name | (3aR,7S,7aS)-5-bromo-7-[tert-butyl(dimethyl)silyl]oxy-2,2-dimethyl-7,7a-dihydro-3aH-1,3-benzodioxol-4-one |
| SMILES | CC1(C)O[C@@H]2[C@@H](O[Si](C)(C)C(C)(C)C)C=C(Br)C(=O)[C@@H]2O1 |
| InChI | InChI=1S/C15H25BrO4Si/c1-14(2,3)21(6,7)20-10-8-9(16)11(17)13-12(10)18-15(4,5)19-13/h8,10,12-13H,1-7H3/t10-,12+,13-/m0/s1 |
| InChIKey | MGMBOLUOKGSANN-UHTWSYAYSA-N |
| XLogP | 3.76 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.35 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|