C19H16N5O2S+ — CID 10339561
4-[2-[(2E)-2-[(4-methylphenyl)methylidene]hydrazinyl]-1,3-thiazol-4-yl]-3-phenyl-2H-oxadiazol-3-ium-5-one (PubChem CID 10339561) has the molecular formula C19H16N5O2S+ and a molecular weight of 378.44 g/mol. Its IUPAC name is 4-[2-[(2E)-2-[(4-methylphenyl)methylidene]hydrazinyl]-1,3-thiazol-4-yl]-3-phenyl-2H-oxadiazol-3-ium-5-one.
| Compound Name | 4-[2-[(2E)-2-[(4-methylphenyl)methylidene]hydrazinyl]-1,3-thiazol-4-yl]-3-phenyl-2H-oxadiazol-3-ium-5-one |
|---|---|
| PubChem CID | 10339561 |
| Molecular Formula | C19H16N5O2S+ |
| Molecular Weight | 378.44 g/mol |
| Exact Mass | 378.10 |
| IUPAC Name | 4-[2-[(2E)-2-[(4-methylphenyl)methylidene]hydrazinyl]-1,3-thiazol-4-yl]-3-phenyl-2H-oxadiazol-3-ium-5-one |
| SMILES | Cc1ccc(/C=N/Nc2nc(-c3c(=O)o[nH][n+]3-c3ccccc3)cs2)cc1 |
| InChI | InChI=1S/C19H15N5O2S/c1-13-7-9-14(10-8-13)11-20-22-19-21-16(12-27-19)17-18(25)26-23-24(17)15-5-3-2-4-6-15/h2-12H,1H3,(H-,21,22,23,25)/p+1/b20-11+ |
| InChIKey | NYOMCLDHVLMNBI-RGVLZGJSSA-O |
| XLogP | 3.12 |
| TPSA | 87.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.44 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|