C17H26FNO2 — CID 103395911
(1-ethoxy-3-methylcyclohexyl)-(2-fluoro-4-methoxyphenyl)methanamine (PubChem CID 103395911) has the molecular formula C17H26FNO2 and a molecular weight of 295.40 g/mol. Its IUPAC name is (1-ethoxy-3-methylcyclohexyl)-(2-fluoro-4-methoxyphenyl)methanamine.
| Compound Name | (1-ethoxy-3-methylcyclohexyl)-(2-fluoro-4-methoxyphenyl)methanamine |
|---|---|
| PubChem CID | 103395911 |
| Molecular Formula | C17H26FNO2 |
| Molecular Weight | 295.40 g/mol |
| Exact Mass | 295.19 |
| IUPAC Name | (1-ethoxy-3-methylcyclohexyl)-(2-fluoro-4-methoxyphenyl)methanamine |
| SMILES | CCOC1(C(N)c2ccc(OC)cc2F)CCCC(C)C1 |
| InChI | InChI=1S/C17H26FNO2/c1-4-21-17(9-5-6-12(2)11-17)16(19)14-8-7-13(20-3)10-15(14)18/h7-8,10,12,16H,4-6,9,11,19H2,1-3H3 |
| InChIKey | WLBBGRUCEYELKS-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.40 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |