C16H23F2NO — CID 116768109
(2,4-difluorophenyl)-(1-ethoxy-3-methylcyclohexyl)methanamine (PubChem CID 116768109) has the molecular formula C16H23F2NO and a molecular weight of 283.36 g/mol. Its IUPAC name is (2,4-difluorophenyl)-(1-ethoxy-3-methylcyclohexyl)methanamine.
| Compound Name | (2,4-difluorophenyl)-(1-ethoxy-3-methylcyclohexyl)methanamine |
|---|---|
| PubChem CID | 116768109 |
| Molecular Formula | C16H23F2NO |
| Molecular Weight | 283.36 g/mol |
| Exact Mass | 283.17 |
| IUPAC Name | (2,4-difluorophenyl)-(1-ethoxy-3-methylcyclohexyl)methanamine |
| SMILES | CCOC1(C(N)c2ccc(F)cc2F)CCCC(C)C1 |
| InChI | InChI=1S/C16H23F2NO/c1-3-20-16(8-4-5-11(2)10-16)15(19)13-7-6-12(17)9-14(13)18/h6-7,9,11,15H,3-5,8,10,19H2,1-2H3 |
| InChIKey | MJOZMLCCDYVBPY-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.36 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |