C18H21NO4S2 — CID 10339685
diethyl 2-[(2-aminophenyl)sulfanyl-thiophen-2-ylmethyl]propanedioate (PubChem CID 10339685) has the molecular formula C18H21NO4S2 and a molecular weight of 379.50 g/mol. Its IUPAC name is diethyl 2-[(2-aminophenyl)sulfanyl-thiophen-2-ylmethyl]propanedioate.
| Compound Name | diethyl 2-[(2-aminophenyl)sulfanyl-thiophen-2-ylmethyl]propanedioate |
|---|---|
| PubChem CID | 10339685 |
| Molecular Formula | C18H21NO4S2 |
| Molecular Weight | 379.50 g/mol |
| Exact Mass | 379.09 |
| IUPAC Name | diethyl 2-[(2-aminophenyl)sulfanyl-thiophen-2-ylmethyl]propanedioate |
| SMILES | CCOC(=O)C(C(=O)OCC)C(Sc1ccccc1N)c1cccs1 |
| InChI | InChI=1S/C18H21NO4S2/c1-3-22-17(20)15(18(21)23-4-2)16(14-10-7-11-24-14)25-13-9-6-5-8-12(13)19/h5-11,15-16H,3-4,19H2,1-2H3 |
| InChIKey | PWOIATDQBARIRS-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 78.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.50 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|