C13H25N3O3 — CID 103397941
tert-butyl 6-(2-ethoxyethylamino)-3,5-dihydro-2H-pyrazine-4-carboxylate (PubChem CID 103397941) has the molecular formula C13H25N3O3 and a molecular weight of 271.36 g/mol. Its IUPAC name is tert-butyl 6-(2-ethoxyethylamino)-3,5-dihydro-2H-pyrazine-4-carboxylate.
| Compound Name | tert-butyl 6-(2-ethoxyethylamino)-3,5-dihydro-2H-pyrazine-4-carboxylate |
|---|---|
| PubChem CID | 103397941 |
| Molecular Formula | C13H25N3O3 |
| Molecular Weight | 271.36 g/mol |
| Exact Mass | 271.19 |
| IUPAC Name | tert-butyl 6-(2-ethoxyethylamino)-3,5-dihydro-2H-pyrazine-4-carboxylate |
| SMILES | CCOCCNC1=NCCN(C(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C13H25N3O3/c1-5-18-9-7-15-11-10-16(8-6-14-11)12(17)19-13(2,3)4/h5-10H2,1-4H3,(H,14,15) |
| InChIKey | XQYWAIIHZKWNQN-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 63.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.36 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|