C13H22F3N3O3 — CID 103398165
tert-butyl 6-[2-(2,2,2-trifluoroethoxy)ethylamino]-3,5-dihydro-2H-pyrazine-4-carboxylate (PubChem CID 103398165) has the molecular formula C13H22F3N3O3 and a molecular weight of 325.33 g/mol. Its IUPAC name is tert-butyl 6-[2-(2,2,2-trifluoroethoxy)ethylamino]-3,5-dihydro-2H-pyrazine-4-carboxylate.
| Compound Name | tert-butyl 6-[2-(2,2,2-trifluoroethoxy)ethylamino]-3,5-dihydro-2H-pyrazine-4-carboxylate |
|---|---|
| PubChem CID | 103398165 |
| Molecular Formula | C13H22F3N3O3 |
| Molecular Weight | 325.33 g/mol |
| Exact Mass | 325.16 |
| IUPAC Name | tert-butyl 6-[2-(2,2,2-trifluoroethoxy)ethylamino]-3,5-dihydro-2H-pyrazine-4-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCN=C(NCCOCC(F)(F)F)C1 |
| InChI | InChI=1S/C13H22F3N3O3/c1-12(2,3)22-11(20)19-6-4-17-10(8-19)18-5-7-21-9-13(14,15)16/h4-9H2,1-3H3,(H,17,18) |
| InChIKey | IFLDFAHLCOSUTD-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 63.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.33 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|