C14H24F3N3O2 — CID 103398291
tert-butyl 6-(5,5,5-trifluoropentylamino)-3,5-dihydro-2H-pyrazine-4-carboxylate (PubChem CID 103398291) has the molecular formula C14H24F3N3O2 and a molecular weight of 323.36 g/mol. Its IUPAC name is tert-butyl 6-(5,5,5-trifluoropentylamino)-3,5-dihydro-2H-pyrazine-4-carboxylate.
| Compound Name | tert-butyl 6-(5,5,5-trifluoropentylamino)-3,5-dihydro-2H-pyrazine-4-carboxylate |
|---|---|
| PubChem CID | 103398291 |
| Molecular Formula | C14H24F3N3O2 |
| Molecular Weight | 323.36 g/mol |
| Exact Mass | 323.18 |
| IUPAC Name | tert-butyl 6-(5,5,5-trifluoropentylamino)-3,5-dihydro-2H-pyrazine-4-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCN=C(NCCCCC(F)(F)F)C1 |
| InChI | InChI=1S/C14H24F3N3O2/c1-13(2,3)22-12(21)20-9-8-19-11(10-20)18-7-5-4-6-14(15,16)17/h4-10H2,1-3H3,(H,18,19) |
| InChIKey | OPCCXNMBGOKEQX-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 53.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.36 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|