C12H19F4N3O2 — CID 106293719
tert-butyl 6-(2,2,3,3-tetrafluoropropylamino)-3,5-dihydro-2H-pyrazine-4-carboxylate (PubChem CID 106293719) has the molecular formula C12H19F4N3O2 and a molecular weight of 313.30 g/mol. Its IUPAC name is tert-butyl 6-(2,2,3,3-tetrafluoropropylamino)-3,5-dihydro-2H-pyrazine-4-carboxylate.
| Compound Name | tert-butyl 6-(2,2,3,3-tetrafluoropropylamino)-3,5-dihydro-2H-pyrazine-4-carboxylate |
|---|---|
| PubChem CID | 106293719 |
| Molecular Formula | C12H19F4N3O2 |
| Molecular Weight | 313.30 g/mol |
| Exact Mass | 313.14 |
| IUPAC Name | tert-butyl 6-(2,2,3,3-tetrafluoropropylamino)-3,5-dihydro-2H-pyrazine-4-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCN=C(NCC(F)(F)C(F)F)C1 |
| InChI | InChI=1S/C12H19F4N3O2/c1-11(2,3)21-10(20)19-5-4-17-8(6-19)18-7-12(15,16)9(13)14/h9H,4-7H2,1-3H3,(H,17,18) |
| InChIKey | GTLXUIFDLRNKID-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 53.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.30 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|