C14H24F3N4O2+ — CID 144563756
tert-butyl 5-amino-3,3,6-trimethyl-4-(2,2,2-trifluoroethanimidoyl)-2,6-dihydropyrazin-4-ium-1-carboxylate (PubChem CID 144563756) has the molecular formula C14H24F3N4O2+ and a molecular weight of 337.37 g/mol. Its IUPAC name is tert-butyl 5-amino-3,3,6-trimethyl-4-(2,2,2-trifluoroethanimidoyl)-2,6-dihydropyrazin-4-ium-1-carboxylate.
| Compound Name | tert-butyl 5-amino-3,3,6-trimethyl-4-(2,2,2-trifluoroethanimidoyl)-2,6-dihydropyrazin-4-ium-1-carboxylate |
|---|---|
| PubChem CID | 144563756 |
| Molecular Formula | C14H24F3N4O2+ |
| Molecular Weight | 337.37 g/mol |
| Exact Mass | 337.18 |
| IUPAC Name | tert-butyl 5-amino-3,3,6-trimethyl-4-(2,2,2-trifluoroethanimidoyl)-2,6-dihydropyrazin-4-ium-1-carboxylate |
| SMILES | [H]/N=C(/[N+]1=C(N)C(C)N(C(=O)OC(C)(C)C)CC1(C)C)C(F)(F)F |
| InChI | InChI=1S/C14H23F3N4O2/c1-8-9(18)21(10(19)14(15,16)17)13(5,6)7-20(8)11(22)23-12(2,3)4/h8,18-19H,7H2,1-6H3/p+1/b19-10+ |
| InChIKey | HWOMJKWSWRPEFA-VXLYETTFSA-O |
| XLogP | 2.31 |
| TPSA | 82.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.37 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|