C13H21F3N4O2 — CID 144563749
tert-butyl 3-ethyl-5-imino-4-(2,2,2-trifluoroethanimidoyl)piperazine-1-carboxylate (PubChem CID 144563749) has the molecular formula C13H21F3N4O2 and a molecular weight of 322.33 g/mol. Its IUPAC name is tert-butyl 3-ethyl-5-imino-4-(2,2,2-trifluoroethanimidoyl)piperazine-1-carboxylate.
| Compound Name | tert-butyl 3-ethyl-5-imino-4-(2,2,2-trifluoroethanimidoyl)piperazine-1-carboxylate |
|---|---|
| PubChem CID | 144563749 |
| Molecular Formula | C13H21F3N4O2 |
| Molecular Weight | 322.33 g/mol |
| Exact Mass | 322.16 |
| IUPAC Name | tert-butyl 3-ethyl-5-imino-4-(2,2,2-trifluoroethanimidoyl)piperazine-1-carboxylate |
| SMILES | [H]/N=C1\CN(C(=O)OC(C)(C)C)CC(CC)N1/C(=N/[H])C(F)(F)F |
| InChI | InChI=1S/C13H21F3N4O2/c1-5-8-6-19(11(21)22-12(2,3)4)7-9(17)20(8)10(18)13(14,15)16/h8,17-18H,5-7H2,1-4H3/b17-9+,18-10+ |
| InChIKey | NGTIORVQMYLTFX-BEQMOXJMSA-N |
| XLogP | 2.83 |
| TPSA | 80.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.33 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|