C13H21F3N4O3 — CID 144563778
tert-butyl 3-imino-5-methoxy-2-methyl-4-(2,2,2-trifluoroethanimidoyl)piperazine-1-carboxylate (PubChem CID 144563778) has the molecular formula C13H21F3N4O3 and a molecular weight of 338.33 g/mol. Its IUPAC name is tert-butyl 3-imino-5-methoxy-2-methyl-4-(2,2,2-trifluoroethanimidoyl)piperazine-1-carboxylate.
| Compound Name | tert-butyl 3-imino-5-methoxy-2-methyl-4-(2,2,2-trifluoroethanimidoyl)piperazine-1-carboxylate |
|---|---|
| PubChem CID | 144563778 |
| Molecular Formula | C13H21F3N4O3 |
| Molecular Weight | 338.33 g/mol |
| Exact Mass | 338.16 |
| IUPAC Name | tert-butyl 3-imino-5-methoxy-2-methyl-4-(2,2,2-trifluoroethanimidoyl)piperazine-1-carboxylate |
| SMILES | [H]/N=C1\C(C)N(C(=O)OC(C)(C)C)CC(OC)N1/C(=N/[H])C(F)(F)F |
| InChI | InChI=1S/C13H21F3N4O3/c1-7-9(17)20(10(18)13(14,15)16)8(22-5)6-19(7)11(21)23-12(2,3)4/h7-8,17-18H,6H2,1-5H3/b17-9+,18-10+ |
| InChIKey | RALITMHRWMODNT-BEQMOXJMSA-N |
| XLogP | 2.42 |
| TPSA | 89.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.33 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|