C12H19F3N4O3 — CID 144563757
tert-butyl 3-imino-5-methoxy-4-(2,2,2-trifluoroethanimidoyl)piperazine-1-carboxylate (PubChem CID 144563757) has the molecular formula C12H19F3N4O3 and a molecular weight of 324.30 g/mol. Its IUPAC name is tert-butyl 3-imino-5-methoxy-4-(2,2,2-trifluoroethanimidoyl)piperazine-1-carboxylate.
| Compound Name | tert-butyl 3-imino-5-methoxy-4-(2,2,2-trifluoroethanimidoyl)piperazine-1-carboxylate |
|---|---|
| PubChem CID | 144563757 |
| Molecular Formula | C12H19F3N4O3 |
| Molecular Weight | 324.30 g/mol |
| Exact Mass | 324.14 |
| IUPAC Name | tert-butyl 3-imino-5-methoxy-4-(2,2,2-trifluoroethanimidoyl)piperazine-1-carboxylate |
| SMILES | [H]/N=C1\CN(C(=O)OC(C)(C)C)CC(OC)N1/C(=N/[H])C(F)(F)F |
| InChI | InChI=1S/C12H19F3N4O3/c1-11(2,3)22-10(20)18-5-7(16)19(8(6-18)21-4)9(17)12(13,14)15/h8,16-17H,5-6H2,1-4H3/b16-7+,17-9+ |
| InChIKey | RVLNIRXZHCDDJM-UGPOXXRUSA-N |
| XLogP | 2.03 |
| TPSA | 89.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.30 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|