C14H23F3N4O2 — CID 144563767
tert-butyl 5-ethyl-3-imino-2-methyl-4-(2,2,2-trifluoroethanimidoyl)piperazine-1-carboxylate (PubChem CID 144563767) has the molecular formula C14H23F3N4O2 and a molecular weight of 336.36 g/mol. Its IUPAC name is tert-butyl 5-ethyl-3-imino-2-methyl-4-(2,2,2-trifluoroethanimidoyl)piperazine-1-carboxylate.
| Compound Name | tert-butyl 5-ethyl-3-imino-2-methyl-4-(2,2,2-trifluoroethanimidoyl)piperazine-1-carboxylate |
|---|---|
| PubChem CID | 144563767 |
| Molecular Formula | C14H23F3N4O2 |
| Molecular Weight | 336.36 g/mol |
| Exact Mass | 336.18 |
| IUPAC Name | tert-butyl 5-ethyl-3-imino-2-methyl-4-(2,2,2-trifluoroethanimidoyl)piperazine-1-carboxylate |
| SMILES | [H]/N=C1\C(C)N(C(=O)OC(C)(C)C)CC(CC)N1/C(=N/[H])C(F)(F)F |
| InChI | InChI=1S/C14H23F3N4O2/c1-6-9-7-20(12(22)23-13(3,4)5)8(2)10(18)21(9)11(19)14(15,16)17/h8-9,18-19H,6-7H2,1-5H3/b18-10+,19-11+ |
| InChIKey | GUAPCUJYJJKFJU-XOBNHNQQSA-N |
| XLogP | 3.22 |
| TPSA | 80.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.36 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|