C12H23N5O2 — CID 123183334
tert-butyl 4-(3-amino-3-iminopropanimidoyl)piperazine-1-carboxylate (PubChem CID 123183334) has the molecular formula C12H23N5O2 and a molecular weight of 269.35 g/mol. Its IUPAC name is tert-butyl 4-(3-amino-3-iminopropanimidoyl)piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-(3-amino-3-iminopropanimidoyl)piperazine-1-carboxylate |
|---|---|
| PubChem CID | 123183334 |
| Molecular Formula | C12H23N5O2 |
| Molecular Weight | 269.35 g/mol |
| Exact Mass | 269.19 |
| IUPAC Name | tert-butyl 4-(3-amino-3-iminopropanimidoyl)piperazine-1-carboxylate |
| SMILES | [H]/N=C(\N)C/C(=N\[H])N1CCN(C(=O)OC(C)(C)C)CC1 |
| InChI | InChI=1S/C12H23N5O2/c1-12(2,3)19-11(18)17-6-4-16(5-7-17)10(15)8-9(13)14/h15H,4-8H2,1-3H3,(H3,13,14)/b15-10+ |
| InChIKey | LVNIOOMJESVSFX-XNTDXEJSSA-N |
| XLogP | 0.84 |
| TPSA | 106.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.35 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|