C11H18F3N3O2 — CID 131701369
tert-butyl 4-(2,2,2-trifluoroethanimidoyl)piperazine-1-carboxylate (PubChem CID 131701369) has the molecular formula C11H18F3N3O2 and a molecular weight of 281.28 g/mol. Its IUPAC name is tert-butyl 4-(2,2,2-trifluoroethanimidoyl)piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-(2,2,2-trifluoroethanimidoyl)piperazine-1-carboxylate |
|---|---|
| PubChem CID | 131701369 |
| Molecular Formula | C11H18F3N3O2 |
| Molecular Weight | 281.28 g/mol |
| Exact Mass | 281.14 |
| IUPAC Name | tert-butyl 4-(2,2,2-trifluoroethanimidoyl)piperazine-1-carboxylate |
| SMILES | [H]/N=C(\N1CCN(C(=O)OC(C)(C)C)CC1)C(F)(F)F |
| InChI | InChI=1S/C11H18F3N3O2/c1-10(2,3)19-9(18)17-6-4-16(5-7-17)8(15)11(12,13)14/h15H,4-7H2,1-3H3/b15-8- |
| InChIKey | BDIFPBDQOKIASS-NVNXTCNLSA-N |
| XLogP | 2.08 |
| TPSA | 56.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.28 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|