C16H29N3O3 — CID 103398163
tert-butyl 6-(2-cyclopentyloxyethylamino)-3,5-dihydro-2H-pyrazine-4-carboxylate (PubChem CID 103398163) has the molecular formula C16H29N3O3 and a molecular weight of 311.43 g/mol. Its IUPAC name is tert-butyl 6-(2-cyclopentyloxyethylamino)-3,5-dihydro-2H-pyrazine-4-carboxylate.
| Compound Name | tert-butyl 6-(2-cyclopentyloxyethylamino)-3,5-dihydro-2H-pyrazine-4-carboxylate |
|---|---|
| PubChem CID | 103398163 |
| Molecular Formula | C16H29N3O3 |
| Molecular Weight | 311.43 g/mol |
| Exact Mass | 311.22 |
| IUPAC Name | tert-butyl 6-(2-cyclopentyloxyethylamino)-3,5-dihydro-2H-pyrazine-4-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCN=C(NCCOC2CCCC2)C1 |
| InChI | InChI=1S/C16H29N3O3/c1-16(2,3)22-15(20)19-10-8-17-14(12-19)18-9-11-21-13-6-4-5-7-13/h13H,4-12H2,1-3H3,(H,17,18) |
| InChIKey | DJYXNDDBLMJDKF-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 63.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.43 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|