C12H20F3N3O2S — CID 106430845
tert-butyl 6-[2-(trifluoromethylsulfanyl)ethylamino]-3,5-dihydro-2H-pyrazine-4-carboxylate (PubChem CID 106430845) has the molecular formula C12H20F3N3O2S and a molecular weight of 327.37 g/mol. Its IUPAC name is tert-butyl 6-[2-(trifluoromethylsulfanyl)ethylamino]-3,5-dihydro-2H-pyrazine-4-carboxylate.
| Compound Name | tert-butyl 6-[2-(trifluoromethylsulfanyl)ethylamino]-3,5-dihydro-2H-pyrazine-4-carboxylate |
|---|---|
| PubChem CID | 106430845 |
| Molecular Formula | C12H20F3N3O2S |
| Molecular Weight | 327.37 g/mol |
| Exact Mass | 327.12 |
| IUPAC Name | tert-butyl 6-[2-(trifluoromethylsulfanyl)ethylamino]-3,5-dihydro-2H-pyrazine-4-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCN=C(NCCSC(F)(F)F)C1 |
| InChI | InChI=1S/C12H20F3N3O2S/c1-11(2,3)20-10(19)18-6-4-16-9(8-18)17-5-7-21-12(13,14)15/h4-8H2,1-3H3,(H,16,17) |
| InChIKey | DGLSXQJTWIVRTC-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 53.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.37 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|