C18H23Cl2N3O2 — CID 10339961
N-(4-butylphenyl)-4,6-dichloro-5-(2,2-dimethoxyethyl)pyrimidin-2-amine (PubChem CID 10339961) has the molecular formula C18H23Cl2N3O2 and a molecular weight of 384.31 g/mol. Its IUPAC name is N-(4-butylphenyl)-4,6-dichloro-5-(2,2-dimethoxyethyl)pyrimidin-2-amine.
| Compound Name | N-(4-butylphenyl)-4,6-dichloro-5-(2,2-dimethoxyethyl)pyrimidin-2-amine |
|---|---|
| PubChem CID | 10339961 |
| Molecular Formula | C18H23Cl2N3O2 |
| Molecular Weight | 384.31 g/mol |
| Exact Mass | 383.12 |
| IUPAC Name | N-(4-butylphenyl)-4,6-dichloro-5-(2,2-dimethoxyethyl)pyrimidin-2-amine |
| SMILES | CCCCc1ccc(Nc2nc(Cl)c(CC(OC)OC)c(Cl)n2)cc1 |
| InChI | InChI=1S/C18H23Cl2N3O2/c1-4-5-6-12-7-9-13(10-8-12)21-18-22-16(19)14(17(20)23-18)11-15(24-2)25-3/h7-10,15H,4-6,11H2,1-3H3,(H,21,22,23) |
| InChIKey | WHWJLUAWYREREL-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 56.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.31 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|