C15H23NO3S2 — CID 103402530
2-ethylsulfanyl-6-[3-(2-methoxyethoxy)propoxy]benzenecarbothioamide (PubChem CID 103402530) has the molecular formula C15H23NO3S2 and a molecular weight of 329.49 g/mol. Its IUPAC name is 2-ethylsulfanyl-6-[3-(2-methoxyethoxy)propoxy]benzenecarbothioamide.
| Compound Name | 2-ethylsulfanyl-6-[3-(2-methoxyethoxy)propoxy]benzenecarbothioamide |
|---|---|
| PubChem CID | 103402530 |
| Molecular Formula | C15H23NO3S2 |
| Molecular Weight | 329.49 g/mol |
| Exact Mass | 329.11 |
| IUPAC Name | 2-ethylsulfanyl-6-[3-(2-methoxyethoxy)propoxy]benzenecarbothioamide |
| SMILES | CCSc1cccc(OCCCOCCOC)c1C(N)=S |
| InChI | InChI=1S/C15H23NO3S2/c1-3-21-13-7-4-6-12(14(13)15(16)20)19-9-5-8-18-11-10-17-2/h4,6-7H,3,5,8-11H2,1-2H3,(H2,16,20) |
| InChIKey | WMYAFOINLCVDCG-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 53.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.49 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|