C12H17BrO4S — CID 103403696
1-(3-bromothiophen-2-yl)-2-[3-(2-methoxyethoxy)propoxy]ethanone (PubChem CID 103403696) has the molecular formula C12H17BrO4S and a molecular weight of 337.24 g/mol. Its IUPAC name is 1-(3-bromothiophen-2-yl)-2-[3-(2-methoxyethoxy)propoxy]ethanone.
| Compound Name | 1-(3-bromothiophen-2-yl)-2-[3-(2-methoxyethoxy)propoxy]ethanone |
|---|---|
| PubChem CID | 103403696 |
| Molecular Formula | C12H17BrO4S |
| Molecular Weight | 337.24 g/mol |
| Exact Mass | 336.00 |
| IUPAC Name | 1-(3-bromothiophen-2-yl)-2-[3-(2-methoxyethoxy)propoxy]ethanone |
| SMILES | COCCOCCCOCC(=O)c1sccc1Br |
| InChI | InChI=1S/C12H17BrO4S/c1-15-6-7-16-4-2-5-17-9-11(14)12-10(13)3-8-18-12/h3,8H,2,4-7,9H2,1H3 |
| InChIKey | ZANDWRRWBWGNLC-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.24 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|