C12H15BrN2O2S — CID 55170555
3-[[2-(3-bromothiophen-2-yl)-2-oxoethyl]-(2-methoxyethyl)amino]propanenitrile (PubChem CID 55170555) has the molecular formula C12H15BrN2O2S and a molecular weight of 331.24 g/mol. Its IUPAC name is 3-[[2-(3-bromothiophen-2-yl)-2-oxoethyl]-(2-methoxyethyl)amino]propanenitrile.
| Compound Name | 3-[[2-(3-bromothiophen-2-yl)-2-oxoethyl]-(2-methoxyethyl)amino]propanenitrile |
|---|---|
| PubChem CID | 55170555 |
| Molecular Formula | C12H15BrN2O2S |
| Molecular Weight | 331.24 g/mol |
| Exact Mass | 330.00 |
| IUPAC Name | 3-[[2-(3-bromothiophen-2-yl)-2-oxoethyl]-(2-methoxyethyl)amino]propanenitrile |
| SMILES | COCCN(CCC#N)CC(=O)c1sccc1Br |
| InChI | InChI=1S/C12H15BrN2O2S/c1-17-7-6-15(5-2-4-14)9-11(16)12-10(13)3-8-18-12/h3,8H,2,5-7,9H2,1H3 |
| InChIKey | JYNQOJCEDLWRLP-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 53.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.24 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |