C16H26BrNOS — CID 107870487
2-[bis(3-methylbutyl)amino]-1-(3-bromothiophen-2-yl)ethanone (PubChem CID 107870487) has the molecular formula C16H26BrNOS and a molecular weight of 360.36 g/mol. Its IUPAC name is 2-[bis(3-methylbutyl)amino]-1-(3-bromothiophen-2-yl)ethanone.
| Compound Name | 2-[bis(3-methylbutyl)amino]-1-(3-bromothiophen-2-yl)ethanone |
|---|---|
| PubChem CID | 107870487 |
| Molecular Formula | C16H26BrNOS |
| Molecular Weight | 360.36 g/mol |
| Exact Mass | 359.09 |
| IUPAC Name | 2-[bis(3-methylbutyl)amino]-1-(3-bromothiophen-2-yl)ethanone |
| SMILES | CC(C)CCN(CCC(C)C)CC(=O)c1sccc1Br |
| InChI | InChI=1S/C16H26BrNOS/c1-12(2)5-8-18(9-6-13(3)4)11-15(19)16-14(17)7-10-20-16/h7,10,12-13H,5-6,8-9,11H2,1-4H3 |
| InChIKey | HKFMQNYEPRHGIW-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.36 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |