C12H12Cl2S2 — CID 103404581
3-chloro-2-[chloro-(2,5-dimethylthiophen-3-yl)methyl]-4-methylthiophene (PubChem CID 103404581) has the molecular formula C12H12Cl2S2 and a molecular weight of 291.27 g/mol. Its IUPAC name is 3-chloro-2-[chloro-(2,5-dimethylthiophen-3-yl)methyl]-4-methylthiophene.
| Compound Name | 3-chloro-2-[chloro-(2,5-dimethylthiophen-3-yl)methyl]-4-methylthiophene |
|---|---|
| PubChem CID | 103404581 |
| Molecular Formula | C12H12Cl2S2 |
| Molecular Weight | 291.27 g/mol |
| Exact Mass | 289.98 |
| IUPAC Name | 3-chloro-2-[chloro-(2,5-dimethylthiophen-3-yl)methyl]-4-methylthiophene |
| SMILES | Cc1cc(C(Cl)c2scc(C)c2Cl)c(C)s1 |
| InChI | InChI=1S/C12H12Cl2S2/c1-6-5-15-12(10(6)13)11(14)9-4-7(2)16-8(9)3/h4-5,11H,1-3H3 |
| InChIKey | YIOLSVOSOQIXAA-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.27 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|