C13H10BrClF2OS — CID 103404628
2-[bromo-(2,6-difluoro-4-methoxyphenyl)methyl]-3-chloro-4-methylthiophene (PubChem CID 103404628) has the molecular formula C13H10BrClF2OS and a molecular weight of 367.64 g/mol. Its IUPAC name is 2-[bromo-(2,6-difluoro-4-methoxyphenyl)methyl]-3-chloro-4-methylthiophene.
| Compound Name | 2-[bromo-(2,6-difluoro-4-methoxyphenyl)methyl]-3-chloro-4-methylthiophene |
|---|---|
| PubChem CID | 103404628 |
| Molecular Formula | C13H10BrClF2OS |
| Molecular Weight | 367.64 g/mol |
| Exact Mass | 365.93 |
| IUPAC Name | 2-[bromo-(2,6-difluoro-4-methoxyphenyl)methyl]-3-chloro-4-methylthiophene |
| SMILES | COc1cc(F)c(C(Br)c2scc(C)c2Cl)c(F)c1 |
| InChI | InChI=1S/C13H10BrClF2OS/c1-6-5-19-13(12(6)15)11(14)10-8(16)3-7(18-2)4-9(10)17/h3-5,11H,1-2H3 |
| InChIKey | ORAYSGIWSFRUGQ-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.64 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|