C16H15BrF2O — CID 63435375
2-[1-bromo-2-(2-methylphenyl)ethyl]-1,3-difluoro-5-methoxybenzene (PubChem CID 63435375) has the molecular formula C16H15BrF2O and a molecular weight of 341.20 g/mol. Its IUPAC name is 2-[1-bromo-2-(2-methylphenyl)ethyl]-1,3-difluoro-5-methoxybenzene.
| Compound Name | 2-[1-bromo-2-(2-methylphenyl)ethyl]-1,3-difluoro-5-methoxybenzene |
|---|---|
| PubChem CID | 63435375 |
| Molecular Formula | C16H15BrF2O |
| Molecular Weight | 341.20 g/mol |
| Exact Mass | 340.03 |
| IUPAC Name | 2-[1-bromo-2-(2-methylphenyl)ethyl]-1,3-difluoro-5-methoxybenzene |
| SMILES | COc1cc(F)c(C(Br)Cc2ccccc2C)c(F)c1 |
| InChI | InChI=1S/C16H15BrF2O/c1-10-5-3-4-6-11(10)7-13(17)16-14(18)8-12(20-2)9-15(16)19/h3-6,8-9,13H,7H2,1-2H3 |
| InChIKey | LRCJFBZENTXKIT-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.20 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|