C24H28N2O3 — CID 10340492
3,4-dimethyl-7-[3-(4-phenylpiperazin-1-yl)propoxy]chromen-2-one (PubChem CID 10340492) has the molecular formula C24H28N2O3 and a molecular weight of 392.50 g/mol. Its IUPAC name is 3,4-dimethyl-7-[3-(4-phenylpiperazin-1-yl)propoxy]chromen-2-one.
| Compound Name | 3,4-dimethyl-7-[3-(4-phenylpiperazin-1-yl)propoxy]chromen-2-one |
|---|---|
| PubChem CID | 10340492 |
| Molecular Formula | C24H28N2O3 |
| Molecular Weight | 392.50 g/mol |
| Exact Mass | 392.21 |
| IUPAC Name | 3,4-dimethyl-7-[3-(4-phenylpiperazin-1-yl)propoxy]chromen-2-one |
| SMILES | Cc1c(C)c2ccc(OCCCN3CCN(c4ccccc4)CC3)cc2oc1=O |
| InChI | InChI=1S/C24H28N2O3/c1-18-19(2)24(27)29-23-17-21(9-10-22(18)23)28-16-6-11-25-12-14-26(15-13-25)20-7-4-3-5-8-20/h3-5,7-10,17H,6,11-16H2,1-2H3 |
| InChIKey | LNAQGJPALKPMLJ-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 45.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.50 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|