C11H16ClNOS — CID 103406022
1-(3-chloro-4-methylthiophen-2-yl)-N-methyl-1-(oxolan-3-yl)methanamine (PubChem CID 103406022) has the molecular formula C11H16ClNOS and a molecular weight of 245.77 g/mol. Its IUPAC name is 1-(3-chloro-4-methylthiophen-2-yl)-N-methyl-1-(oxolan-3-yl)methanamine.
| Compound Name | 1-(3-chloro-4-methylthiophen-2-yl)-N-methyl-1-(oxolan-3-yl)methanamine |
|---|---|
| PubChem CID | 103406022 |
| Molecular Formula | C11H16ClNOS |
| Molecular Weight | 245.77 g/mol |
| Exact Mass | 245.06 |
| IUPAC Name | 1-(3-chloro-4-methylthiophen-2-yl)-N-methyl-1-(oxolan-3-yl)methanamine |
| SMILES | CNC(c1scc(C)c1Cl)C1CCOC1 |
| InChI | InChI=1S/C11H16ClNOS/c1-7-6-15-11(9(7)12)10(13-2)8-3-4-14-5-8/h6,8,10,13H,3-5H2,1-2H3 |
| InChIKey | YWKMIGOWDUZKRM-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.77 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |