C13H21ClN2S — CID 103408753
[(3-chloro-4-methylthiophen-2-yl)-cycloheptylmethyl]hydrazine (PubChem CID 103408753) has the molecular formula C13H21ClN2S and a molecular weight of 272.84 g/mol. Its IUPAC name is [(3-chloro-4-methylthiophen-2-yl)-cycloheptylmethyl]hydrazine.
| Compound Name | [(3-chloro-4-methylthiophen-2-yl)-cycloheptylmethyl]hydrazine |
|---|---|
| PubChem CID | 103408753 |
| Molecular Formula | C13H21ClN2S |
| Molecular Weight | 272.84 g/mol |
| Exact Mass | 272.11 |
| IUPAC Name | [(3-chloro-4-methylthiophen-2-yl)-cycloheptylmethyl]hydrazine |
| SMILES | Cc1csc(C(NN)C2CCCCCC2)c1Cl |
| InChI | InChI=1S/C13H21ClN2S/c1-9-8-17-13(11(9)14)12(16-15)10-6-4-2-3-5-7-10/h8,10,12,16H,2-7,15H2,1H3 |
| InChIKey | IMMVICFZXGBZOG-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.84 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|