C12H20ClNO2S2 — CID 103406210
1-(3-chloro-4-methylthiophen-2-yl)-4-ethylsulfonyl-N-methylbutan-1-amine (PubChem CID 103406210) has the molecular formula C12H20ClNO2S2 and a molecular weight of 309.88 g/mol. Its IUPAC name is 1-(3-chloro-4-methylthiophen-2-yl)-4-ethylsulfonyl-N-methylbutan-1-amine.
| Compound Name | 1-(3-chloro-4-methylthiophen-2-yl)-4-ethylsulfonyl-N-methylbutan-1-amine |
|---|---|
| PubChem CID | 103406210 |
| Molecular Formula | C12H20ClNO2S2 |
| Molecular Weight | 309.88 g/mol |
| Exact Mass | 309.06 |
| IUPAC Name | 1-(3-chloro-4-methylthiophen-2-yl)-4-ethylsulfonyl-N-methylbutan-1-amine |
| SMILES | CCS(=O)(=O)CCCC(NC)c1scc(C)c1Cl |
| InChI | InChI=1S/C12H20ClNO2S2/c1-4-18(15,16)7-5-6-10(14-3)12-11(13)9(2)8-17-12/h8,10,14H,4-7H2,1-3H3 |
| InChIKey | BERISDHAZSBIKN-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.88 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |