C14H24ClNO2S2 — CID 103406216
1-(3-chloro-4-methylthiophen-2-yl)-4-ethylsulfonyl-N-propylbutan-1-amine (PubChem CID 103406216) has the molecular formula C14H24ClNO2S2 and a molecular weight of 337.94 g/mol. Its IUPAC name is 1-(3-chloro-4-methylthiophen-2-yl)-4-ethylsulfonyl-N-propylbutan-1-amine.
| Compound Name | 1-(3-chloro-4-methylthiophen-2-yl)-4-ethylsulfonyl-N-propylbutan-1-amine |
|---|---|
| PubChem CID | 103406216 |
| Molecular Formula | C14H24ClNO2S2 |
| Molecular Weight | 337.94 g/mol |
| Exact Mass | 337.09 |
| IUPAC Name | 1-(3-chloro-4-methylthiophen-2-yl)-4-ethylsulfonyl-N-propylbutan-1-amine |
| SMILES | CCCNC(CCCS(=O)(=O)CC)c1scc(C)c1Cl |
| InChI | InChI=1S/C14H24ClNO2S2/c1-4-8-16-12(7-6-9-20(17,18)5-2)14-13(15)11(3)10-19-14/h10,12,16H,4-9H2,1-3H3 |
| InChIKey | QYAMYTARNJBVJY-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.94 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |