C12H21NO4 — CID 103406388
[2-[3-(2-methoxyethoxy)propoxymethyl]furan-3-yl]methanamine (PubChem CID 103406388) has the molecular formula C12H21NO4 and a molecular weight of 243.30 g/mol. Its IUPAC name is [2-[3-(2-methoxyethoxy)propoxymethyl]furan-3-yl]methanamine.
| Compound Name | [2-[3-(2-methoxyethoxy)propoxymethyl]furan-3-yl]methanamine |
|---|---|
| PubChem CID | 103406388 |
| Molecular Formula | C12H21NO4 |
| Molecular Weight | 243.30 g/mol |
| Exact Mass | 243.15 |
| IUPAC Name | [2-[3-(2-methoxyethoxy)propoxymethyl]furan-3-yl]methanamine |
| SMILES | COCCOCCCOCc1occc1CN |
| InChI | InChI=1S/C12H21NO4/c1-14-7-8-15-4-2-5-16-10-12-11(9-13)3-6-17-12/h3,6H,2,4-5,7-10,13H2,1H3 |
| InChIKey | UVXBDUYDPHKXIU-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 66.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.30 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|