C13H23NO4 — CID 103406682
[5-[3-(2-methoxyethoxy)propoxymethyl]-2-methylfuran-3-yl]methanamine (PubChem CID 103406682) has the molecular formula C13H23NO4 and a molecular weight of 257.33 g/mol. Its IUPAC name is [5-[3-(2-methoxyethoxy)propoxymethyl]-2-methylfuran-3-yl]methanamine.
| Compound Name | [5-[3-(2-methoxyethoxy)propoxymethyl]-2-methylfuran-3-yl]methanamine |
|---|---|
| PubChem CID | 103406682 |
| Molecular Formula | C13H23NO4 |
| Molecular Weight | 257.33 g/mol |
| Exact Mass | 257.16 |
| IUPAC Name | [5-[3-(2-methoxyethoxy)propoxymethyl]-2-methylfuran-3-yl]methanamine |
| SMILES | COCCOCCCOCc1cc(CN)c(C)o1 |
| InChI | InChI=1S/C13H23NO4/c1-11-12(9-14)8-13(18-11)10-17-5-3-4-16-7-6-15-2/h8H,3-7,9-10,14H2,1-2H3 |
| InChIKey | VDGREXGWIVAROR-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 66.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.33 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|