About 4-(4-chlorophenyl)-5-[2-(diethylamino)ethyl]-3-methyl-6-phenyl-1,4-dihydropyrimidin-2-one
4-(4-chlorophenyl)-5-[2-(diethylamino)ethyl]-3-methyl-6-phenyl-1,4-dihydropyrimidin-2-one (PubChem CID 10340786) has the molecular formula C23H28ClN3O
and a molecular weight of 397.95 g/mol. Its IUPAC name is 4-(4-chlorophenyl)-5-[2-(diethylamino)ethyl]-3-methyl-6-phenyl-1,4-dihydropyrimidin-2-one.
Molecular Properties
| Compound Name | 4-(4-chlorophenyl)-5-[2-(diethylamino)ethyl]-3-methyl-6-phenyl-1,4-dihydropyrimidin-2-one |
| PubChem CID | 10340786 |
| Molecular Formula | C23H28ClN3O |
| Molecular Weight | 397.95 g/mol |
| Exact Mass | 397.19 |
| IUPAC Name | 4-(4-chlorophenyl)-5-[2-(diethylamino)ethyl]-3-methyl-6-phenyl-1,4-dihydropyrimidin-2-one |
| SMILES | CCN(CC)CCC1=C(c2ccccc2)NC(=O)N(C)C1c1ccc(Cl)cc1 |
| InChI | InChI=1S/C23H28ClN3O/c1-4-27(5-2)16-15-20-21(17-9-7-6-8-10-17)25-23(28)26(3)22(20)18-11-13-19(24)14-12-18/h6-14,22H,4-5,15-16H2,1-3H3,(H,25,28) |
| InChIKey | LXEPYDWSLLSSIS-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 397.95 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-(4-chlorophenyl)-5-[2-(diethylamino)ethyl]-3-methyl-6-phenyl-1,4-dihydropyrimidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(4-chlorophenyl)-5-[2-(diethylamino)ethyl]-3-methyl-6-phenyl-1,4-dihydropyrimidin-2-one?
The IUPAC name of 4-(4-chlorophenyl)-5-[2-(diethylamino)ethyl]-3-methyl-6-phenyl-1,4-dihydropyrimidin-2-one (CID 10340786) is 4-(4-chlorophenyl)-5-[2-(diethylamino)ethyl]-3-methyl-6-phenyl-1,4-dihydropyrimidin-2-one.
What is the SMILES notation for 4-(4-chlorophenyl)-5-[2-(diethylamino)ethyl]-3-methyl-6-phenyl-1,4-dihydropyrimidin-2-one?
The canonical SMILES for 4-(4-chlorophenyl)-5-[2-(diethylamino)ethyl]-3-methyl-6-phenyl-1,4-dihydropyrimidin-2-one is CCN(CC)CCC1=C(c2ccccc2)NC(=O)N(C)C1c1ccc(Cl)cc1.
What is the InChIKey of 4-(4-chlorophenyl)-5-[2-(diethylamino)ethyl]-3-methyl-6-phenyl-1,4-dihydropyrimidin-2-one?
The InChIKey is LXEPYDWSLLSSIS-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H28ClN3O/c1-4-27(5-2)16-15-20-21(17-9-7-6-8-10-17)25-23(28)26(3)22(20)18-11-13-19(24)14-12-18/h6-14,22H,4-5,15-16H2,1-3H3,(H,25,28).
What are the key properties of 4-(4-chlorophenyl)-5-[2-(diethylamino)ethyl]-3-methyl-6-phenyl-1,4-dihydropyrimidin-2-one?
4-(4-chlorophenyl)-5-[2-(diethylamino)ethyl]-3-methyl-6-phenyl-1,4-dihydropyrimidin-2-one has a molecular weight of 397.95 g/mol, XLogP of 5.18, 7 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(4-chlorophenyl)-5-[2-(diethylamino)ethyl]-3-methyl-6-phenyl-1,4-dihydropyrimidin-2-one is sourced from PubChem (CID 10340786), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).