C12H14BrClN2OS — CID 103408262
(4-bromo-1-propylpyrazol-5-yl)-(3-chloro-4-methylthiophen-2-yl)methanol (PubChem CID 103408262) has the molecular formula C12H14BrClN2OS and a molecular weight of 349.68 g/mol. Its IUPAC name is (4-bromo-1-propylpyrazol-5-yl)-(3-chloro-4-methylthiophen-2-yl)methanol.
| Compound Name | (4-bromo-1-propylpyrazol-5-yl)-(3-chloro-4-methylthiophen-2-yl)methanol |
|---|---|
| PubChem CID | 103408262 |
| Molecular Formula | C12H14BrClN2OS |
| Molecular Weight | 349.68 g/mol |
| Exact Mass | 347.97 |
| IUPAC Name | (4-bromo-1-propylpyrazol-5-yl)-(3-chloro-4-methylthiophen-2-yl)methanol |
| SMILES | CCCn1ncc(Br)c1C(O)c1scc(C)c1Cl |
| InChI | InChI=1S/C12H14BrClN2OS/c1-3-4-16-10(8(13)5-15-16)11(17)12-9(14)7(2)6-18-12/h5-6,11,17H,3-4H2,1-2H3 |
| InChIKey | SRUPSUFJDJWNNB-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.68 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |