C12H15BrClN3S — CID 103407340
1-(4-bromo-1-ethylpyrazol-5-yl)-1-(3-chloro-4-methylthiophen-2-yl)-N-methylmethanamine (PubChem CID 103407340) has the molecular formula C12H15BrClN3S and a molecular weight of 348.70 g/mol. Its IUPAC name is 1-(4-bromo-1-ethylpyrazol-5-yl)-1-(3-chloro-4-methylthiophen-2-yl)-N-methylmethanamine.
| Compound Name | 1-(4-bromo-1-ethylpyrazol-5-yl)-1-(3-chloro-4-methylthiophen-2-yl)-N-methylmethanamine |
|---|---|
| PubChem CID | 103407340 |
| Molecular Formula | C12H15BrClN3S |
| Molecular Weight | 348.70 g/mol |
| Exact Mass | 346.99 |
| IUPAC Name | 1-(4-bromo-1-ethylpyrazol-5-yl)-1-(3-chloro-4-methylthiophen-2-yl)-N-methylmethanamine |
| SMILES | CCn1ncc(Br)c1C(NC)c1scc(C)c1Cl |
| InChI | InChI=1S/C12H15BrClN3S/c1-4-17-11(8(13)5-16-17)10(15-3)12-9(14)7(2)6-18-12/h5-6,10,15H,4H2,1-3H3 |
| InChIKey | PUUCNBZWMFKHAH-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.70 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |