C11H13Cl2N3S — CID 105040481
1-(4-chloro-1-ethylpyrazol-5-yl)-1-(3-chlorothiophen-2-yl)-N-methylmethanamine (PubChem CID 105040481) has the molecular formula C11H13Cl2N3S and a molecular weight of 290.22 g/mol. Its IUPAC name is 1-(4-chloro-1-ethylpyrazol-5-yl)-1-(3-chlorothiophen-2-yl)-N-methylmethanamine.
| Compound Name | 1-(4-chloro-1-ethylpyrazol-5-yl)-1-(3-chlorothiophen-2-yl)-N-methylmethanamine |
|---|---|
| PubChem CID | 105040481 |
| Molecular Formula | C11H13Cl2N3S |
| Molecular Weight | 290.22 g/mol |
| Exact Mass | 289.02 |
| IUPAC Name | 1-(4-chloro-1-ethylpyrazol-5-yl)-1-(3-chlorothiophen-2-yl)-N-methylmethanamine |
| SMILES | CCn1ncc(Cl)c1C(NC)c1sccc1Cl |
| InChI | InChI=1S/C11H13Cl2N3S/c1-3-16-10(8(13)6-15-16)9(14-2)11-7(12)4-5-17-11/h4-6,9,14H,3H2,1-2H3 |
| InChIKey | ATEWBJLNHLHWGG-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.22 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |