C10H11Cl2N3S — CID 105040808
(4-chloro-1-ethylpyrazol-5-yl)-(3-chlorothiophen-2-yl)methanamine (PubChem CID 105040808) has the molecular formula C10H11Cl2N3S and a molecular weight of 276.19 g/mol. Its IUPAC name is (4-chloro-1-ethylpyrazol-5-yl)-(3-chlorothiophen-2-yl)methanamine.
| Compound Name | (4-chloro-1-ethylpyrazol-5-yl)-(3-chlorothiophen-2-yl)methanamine |
|---|---|
| PubChem CID | 105040808 |
| Molecular Formula | C10H11Cl2N3S |
| Molecular Weight | 276.19 g/mol |
| Exact Mass | 275.01 |
| IUPAC Name | (4-chloro-1-ethylpyrazol-5-yl)-(3-chlorothiophen-2-yl)methanamine |
| SMILES | CCn1ncc(Cl)c1C(N)c1sccc1Cl |
| InChI | InChI=1S/C10H11Cl2N3S/c1-2-15-9(7(12)5-14-15)8(13)10-6(11)3-4-16-10/h3-5,8H,2,13H2,1H3 |
| InChIKey | HICCOIDGZSSUDJ-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.19 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |