C17H23ClN2S — CID 103408502
[2-(4-tert-butylphenyl)-1-(3-chloro-4-methylthiophen-2-yl)ethyl]hydrazine (PubChem CID 103408502) has the molecular formula C17H23ClN2S and a molecular weight of 322.91 g/mol. Its IUPAC name is [2-(4-tert-butylphenyl)-1-(3-chloro-4-methylthiophen-2-yl)ethyl]hydrazine.
| Compound Name | [2-(4-tert-butylphenyl)-1-(3-chloro-4-methylthiophen-2-yl)ethyl]hydrazine |
|---|---|
| PubChem CID | 103408502 |
| Molecular Formula | C17H23ClN2S |
| Molecular Weight | 322.91 g/mol |
| Exact Mass | 322.13 |
| IUPAC Name | [2-(4-tert-butylphenyl)-1-(3-chloro-4-methylthiophen-2-yl)ethyl]hydrazine |
| SMILES | Cc1csc(C(Cc2ccc(C(C)(C)C)cc2)NN)c1Cl |
| InChI | InChI=1S/C17H23ClN2S/c1-11-10-21-16(15(11)18)14(20-19)9-12-5-7-13(8-6-12)17(2,3)4/h5-8,10,14,20H,9,19H2,1-4H3 |
| InChIKey | ADUPKICLFXYTGD-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.91 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|