C16H21IN2S — CID 105296570
[2-(4-tert-butylphenyl)-1-(5-iodothiophen-3-yl)ethyl]hydrazine (PubChem CID 105296570) has the molecular formula C16H21IN2S and a molecular weight of 400.33 g/mol. Its IUPAC name is [2-(4-tert-butylphenyl)-1-(5-iodothiophen-3-yl)ethyl]hydrazine.
| Compound Name | [2-(4-tert-butylphenyl)-1-(5-iodothiophen-3-yl)ethyl]hydrazine |
|---|---|
| PubChem CID | 105296570 |
| Molecular Formula | C16H21IN2S |
| Molecular Weight | 400.33 g/mol |
| Exact Mass | 400.05 |
| IUPAC Name | [2-(4-tert-butylphenyl)-1-(5-iodothiophen-3-yl)ethyl]hydrazine |
| SMILES | CC(C)(C)c1ccc(CC(NN)c2csc(I)c2)cc1 |
| InChI | InChI=1S/C16H21IN2S/c1-16(2,3)13-6-4-11(5-7-13)8-14(19-18)12-9-15(17)20-10-12/h4-7,9-10,14,19H,8,18H2,1-3H3 |
| InChIKey | NFGVEZJHVUXMOJ-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.33 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|