C14H13F3INOS — CID 115843418
1-(5-iodothiophen-3-yl)-N-methyl-2-[4-(trifluoromethoxy)phenyl]ethanamine (PubChem CID 115843418) has the molecular formula C14H13F3INOS and a molecular weight of 427.23 g/mol. Its IUPAC name is 1-(5-iodothiophen-3-yl)-N-methyl-2-[4-(trifluoromethoxy)phenyl]ethanamine.
| Compound Name | 1-(5-iodothiophen-3-yl)-N-methyl-2-[4-(trifluoromethoxy)phenyl]ethanamine |
|---|---|
| PubChem CID | 115843418 |
| Molecular Formula | C14H13F3INOS |
| Molecular Weight | 427.23 g/mol |
| Exact Mass | 426.97 |
| IUPAC Name | 1-(5-iodothiophen-3-yl)-N-methyl-2-[4-(trifluoromethoxy)phenyl]ethanamine |
| SMILES | CNC(Cc1ccc(OC(F)(F)F)cc1)c1csc(I)c1 |
| InChI | InChI=1S/C14H13F3INOS/c1-19-12(10-7-13(18)21-8-10)6-9-2-4-11(5-3-9)20-14(15,16)17/h2-5,7-8,12,19H,6H2,1H3 |
| InChIKey | CDJUARXBJGFQBU-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.23 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|